![1H-Pyrrolo[2,3-b]pyridine-5-carboxylic acid (CAS: 754214-42-1) - Chemical Structure and Molecular Formula](/static/img/prod_pic/FT-0678319.png "1H-Pyrrolo[2,3-b]pyridine-5-carboxylic acid chemical structure")
1H-Pyrrolo[2,3-b]pyridine-5-carboxylic acid
Catalog No: FT-0678319
CAS No: 754214-42-1
- Chemical Name: 1H-Pyrrolo[2,3-b]pyridine-5-carboxylic acid
- Molecular Formula: C8H6N2O2
- Molecular Weight: 162.15
- InChI Key: SINFYKZXNIJIEU-UHFFFAOYSA-N
- InChI: InChI=1S/C8H6N2O2/c11-8(12)6-3-5-1-2-9-7(5)10-4-6/h1-4H,(H,9,10)(H,11,12)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Product_Name: | 7-Azaindole-5-carboxylic acid |
|---|---|
| Flash_Point: | 224.0±23.2 °C |
| Melting_Point: | N/A |
| FW: | 162.145 |
| Density: | 1.5±0.1 g/cm3 |
| CAS: | 754214-42-1 |
| Bolling_Point: | 446.8±25.0 °C at 760 mmHg |
| MF: | C8H6N2O2 |
| Density: | 1.5±0.1 g/cm3 |
|---|---|
| LogP: | 1.91 |
| Flash_Point: | 224.0±23.2 °C |
| Refractive_Index: | 1.743 |
| FW: | 162.145 |
| PSA: | 65.98000 |
| MF: | C8H6N2O2 |
| Bolling_Point: | 446.8±25.0 °C at 760 mmHg |
| Vapor_Pressure: | 0.0±1.1 mmHg at 25°C |
| Exact_Mass: | 162.042923 |
| Hazard_Codes: | Xi: Irritant; |
|---|---|
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2933990090 |
Related Products
![[R-(E)]-2-Ethylidene-1,5-dimethyl-3,3-diphenyl-pyrrolidine (R-EDDP) (CAS: 106293-55-4) - Related Chemical Product](/static/img/prod_pic/FT-0668298.png "[R-(E)]-2-Ethylidene-1,5-dimethyl-3,3-diphenyl-pyrrolidine (R-EDDP) chemical structure")
[R-(E)]-2-Ethylidene-1,5-dimethyl-3,3-diphenyl-pyrrolidine (R-EDDP)
